CAS 856898-03-8 is the registry number for 2-Fluoro-4'-(trifluoromethyl)-[1,1'-biphenyl]-4-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-fluoro-4-[4-(trifluoromethyl)phenyl]aniline (CAS 856898-03-8) is a chemical compound with the molecular formula C13H9F4N and a molecular weight of 255.21 g/mol. IUPAC name: 3-fluoro-4-[4-(trifluoromethyl)phenyl]aniline. InChIKey: GSZDNLZWLBDIFN-UHFFFAOYSA-N.
| Molecular formula | C13H9F4N |
|---|---|
| Molecular weight | 255.21 g/mol |
| IUPAC name | 3-fluoro-4-[4-(trifluoromethyl)phenyl]aniline |
| InChIKey | GSZDNLZWLBDIFN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)N)F)C(F)(F)F |
Computed by PubChem (NCBI)