CAS 1261846-68-7 is the registry number for (5-Chloro-3-methoxypyridin-2-yl)acetic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(5-chloro-3-methoxy-2-pyridinyl)acetic acid (CAS 1261846-68-7) is a chemical compound with the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. IUPAC name: 2-(5-chloro-3-methoxy-2-pyridinyl)acetic acid. InChIKey: IFSLMNRPDYWKOG-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 2-(5-chloro-3-methoxy-2-pyridinyl)acetic acid |
| InChIKey | IFSLMNRPDYWKOG-UHFFFAOYSA-N |
| SMILES | COC1=C(N=CC(=C1)Cl)CC(=O)O |
Computed by PubChem (NCBI)