CAS 1261861-70-4 is the registry number for 1-[4-Chloro-3-(trifluoromethyl)phenyl]propan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
1-[4-chloro-3-(trifluoromethyl)phenyl]propan-1-one (CAS 1261861-70-4) is a chemical compound with the molecular formula C10H8ClF3O and a molecular weight of 236.62 g/mol. IUPAC name: 1-[4-chloro-3-(trifluoromethyl)phenyl]propan-1-one. InChIKey: QNLBCHOQKWGGFP-UHFFFAOYSA-N.
| Molecular formula | C10H8ClF3O |
|---|---|
| Molecular weight | 236.62 g/mol |
| IUPAC name | 1-[4-chloro-3-(trifluoromethyl)phenyl]propan-1-one |
| InChIKey | QNLBCHOQKWGGFP-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC(=C(C=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)