CAS 139297-83-9 is the registry number for 1-Chloro-3-(3-(trifluoromethyl)phenyl)propan-2-one, 98%. Offered by: AmBeed. Available pack sizes: 5g.
1-chloro-3-[3-(trifluoromethyl)phenyl]propan-2-one (CAS 139297-83-9) is a chemical compound with the molecular formula C10H8ClF3O and a molecular weight of 236.62 g/mol. IUPAC name: 1-chloro-3-[3-(trifluoromethyl)phenyl]propan-2-one. InChIKey: VVDXMNPQTDDCBP-UHFFFAOYSA-N.
| Molecular formula | C10H8ClF3O |
|---|---|
| Molecular weight | 236.62 g/mol |
| IUPAC name | 1-chloro-3-[3-(trifluoromethyl)phenyl]propan-2-one |
| InChIKey | VVDXMNPQTDDCBP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CC(=O)CCl |
Computed by PubChem (NCBI)