Products 1261874-92-3

CAS 1261874-92-3 appears in our catalog under these names: 5-Hydroxy-2-methoxybenzenesulfonyl chloride 95%, 5-Hydroxy-2-methoxybenzenesulfonyl chloride, 98%, 98%, 5-Hydroxy-2-methoxybenzenesulfonyl chloride, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 50mg.

Structural formula: {0} (CAS {1})

5-hydroxy-2-methoxybenzenesulfonyl chloride (CAS 1261874-92-3) is a chemical compound with the molecular formula C7H7ClO4S and a molecular weight of 222.65 g/mol. IUPAC name: 5-hydroxy-2-methoxybenzenesulfonyl chloride. InChIKey: QPWPLOMELUAVLX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7ClO4S
Molecular weight222.65 g/mol
IUPAC name5-hydroxy-2-methoxybenzenesulfonyl chloride
InChIKeyQPWPLOMELUAVLX-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)O)S(=O)(=O)Cl

Computed by PubChem (NCBI)