Products 914261-11-3

CAS 914261-11-3 appears in our catalog under these names: 4-Hydroxy-3-methoxybenzenesulfonyl chloride, 97%, 4-Hydroxy-3-methoxybenzenesulfonyl chloride, 97%, 97%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg.

4-hydroxy-3-methoxybenzenesulfonyl chloride (CAS 914261-11-3) is a chemical compound with the molecular formula C7H7ClO4S and a molecular weight of 222.65 g/mol. IUPAC name: 4-hydroxy-3-methoxybenzenesulfonyl chloride. InChIKey: FCQVTARNBRAROU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7ClO4S
Molecular weight222.65 g/mol
IUPAC name4-hydroxy-3-methoxybenzenesulfonyl chloride
InChIKeyFCQVTARNBRAROU-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)S(=O)(=O)Cl)O

Computed by PubChem (NCBI)