Products 1261895-23-1
CAS 1261895-23-1 is the registry number for 2-Methyl-4-(4-methylsulfonylphenyl)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-methyl-4-(4-methylsulfonylphenyl)phenol (CAS 1261895-23-1) is a chemical compound with the molecular formula C14H14O3S and a molecular weight of 262.33 g/mol. IUPAC name: 2-methyl-4-(4-methylsulfonylphenyl)phenol. InChIKey: BSYKWBZBWWYDAB-UHFFFAOYSA-N.
| Molecular formula | C14H14O3S |
|---|---|
| Molecular weight | 262.33 g/mol |
| IUPAC name | 2-methyl-4-(4-methylsulfonylphenyl)phenol |
| InChIKey | BSYKWBZBWWYDAB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC=C(C=C2)S(=O)(=O)C)O |
Computed by PubChem (NCBI)