CAS 1415562-81-0 is the registry number for PF-543 Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
3-(benzenesulfonylmethyl)-5-methylphenol (CAS 1415562-81-0) is a chemical compound with the molecular formula C14H14O3S and a molecular weight of 262.33 g/mol. IUPAC name: 3-(benzenesulfonylmethyl)-5-methylphenol. InChIKey: CAPGNYHDTGTYQM-UHFFFAOYSA-N.
| Molecular formula | C14H14O3S |
|---|---|
| Molecular weight | 262.33 g/mol |
| IUPAC name | 3-(benzenesulfonylmethyl)-5-methylphenol |
| InChIKey | CAPGNYHDTGTYQM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)O)CS(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)