CAS 1261902-07-1 is the registry number for 4-(3,5-Dimethylphenyl)-3-hydroxybenzoic acid. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
4-(3,5-dimethylphenyl)-3-hydroxybenzoic acid (CAS 1261902-07-1) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 4-(3,5-dimethylphenyl)-3-hydroxybenzoic acid. InChIKey: JDOYBFBIPUSIKI-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 4-(3,5-dimethylphenyl)-3-hydroxybenzoic acid |
| InChIKey | JDOYBFBIPUSIKI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=C(C=C(C=C2)C(=O)O)O)C |
Computed by PubChem (NCBI)