CAS 1261902-83-3 is the registry number for 2-(4-Methoxyphenyl)-6-methylbenzoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(4-methoxyphenyl)-6-methylbenzoic acid (CAS 1261902-83-3) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 2-(4-methoxyphenyl)-6-methylbenzoic acid. InChIKey: FPVPYIAJLDXVQR-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-6-methylbenzoic acid |
| InChIKey | FPVPYIAJLDXVQR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C2=CC=C(C=C2)OC)C(=O)O |
Computed by PubChem (NCBI)