Products 1261908-89-7

CAS 1261908-89-7 is the registry number for 3-Hydroxy-4-(3-trifluoromethoxyphenyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.

Structural formula: {0} (CAS {1})

3-hydroxy-4-[3-(trifluoromethoxy)phenyl]benzoic acid (CAS 1261908-89-7) is a chemical compound with the molecular formula C14H9F3O4 and a molecular weight of 298.21 g/mol. IUPAC name: 3-hydroxy-4-[3-(trifluoromethoxy)phenyl]benzoic acid. InChIKey: ICJXANULUPMIAO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H9F3O4
Molecular weight298.21 g/mol
IUPAC name3-hydroxy-4-[3-(trifluoromethoxy)phenyl]benzoic acid
InChIKeyICJXANULUPMIAO-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)OC(F)(F)F)C2=C(C=C(C=C2)C(=O)O)O

Computed by PubChem (NCBI)