CAS 1261908-89-7 is the registry number for 3-Hydroxy-4-(3-trifluoromethoxyphenyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
3-hydroxy-4-[3-(trifluoromethoxy)phenyl]benzoic acid (CAS 1261908-89-7) is a chemical compound with the molecular formula C14H9F3O4 and a molecular weight of 298.21 g/mol. IUPAC name: 3-hydroxy-4-[3-(trifluoromethoxy)phenyl]benzoic acid. InChIKey: ICJXANULUPMIAO-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O4 |
|---|---|
| Molecular weight | 298.21 g/mol |
| IUPAC name | 3-hydroxy-4-[3-(trifluoromethoxy)phenyl]benzoic acid |
| InChIKey | ICJXANULUPMIAO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)C2=C(C=C(C=C2)C(=O)O)O |
Computed by PubChem (NCBI)