Products 259196-57-1

CAS 259196-57-1 is the registry number for 3-(5-(2-(Trifluoromethoxy)phenyl)furan-2-yl)acrylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

3-[5-[2-(trifluoromethoxy)phenyl]furan-2-yl]prop-2-enoic acid (CAS 259196-57-1) is a chemical compound with the molecular formula C14H9F3O4 and a molecular weight of 298.21 g/mol. IUPAC name: 3-[5-[2-(trifluoromethoxy)phenyl]furan-2-yl]prop-2-enoic acid. InChIKey: NZKLTODPPZSQAT-UHFFFAOYSA-N.

Identity
Molecular formulaC14H9F3O4
Molecular weight298.21 g/mol
IUPAC name3-[5-[2-(trifluoromethoxy)phenyl]furan-2-yl]prop-2-enoic acid
InChIKeyNZKLTODPPZSQAT-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=CC=C(O2)C=CC(=O)O)OC(F)(F)F

Computed by PubChem (NCBI)