Products 1261914-76-4
CAS 1261914-76-4 is the registry number for 2'-Methoxy-[1,1'-biphenyl]-3,4',5-tricarboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-carboxy-2-methoxyphenyl)benzene-1,3-dicarboxylic acid (CAS 1261914-76-4) is a chemical compound with the molecular formula C16H12O7 and a molecular weight of 316.26 g/mol. IUPAC name: 5-(4-carboxy-2-methoxyphenyl)benzene-1,3-dicarboxylic acid. InChIKey: PLLMZOWRLAQLRC-UHFFFAOYSA-N.
| Molecular formula | C16H12O7 |
|---|---|
| Molecular weight | 316.26 g/mol |
| IUPAC name | 5-(4-carboxy-2-methoxyphenyl)benzene-1,3-dicarboxylic acid |
| InChIKey | PLLMZOWRLAQLRC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)O)C2=CC(=CC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)