CAS 1365694-39-8 is the registry number for 5-((2-Carboxybenzyl)oxy)isophthalic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(2-carboxyphenyl)methoxy]benzene-1,3-dicarboxylic acid (CAS 1365694-39-8) is a chemical compound with the molecular formula C16H12O7 and a molecular weight of 316.26 g/mol. IUPAC name: 5-[(2-carboxyphenyl)methoxy]benzene-1,3-dicarboxylic acid. InChIKey: LWQMQSPUNXSIJG-UHFFFAOYSA-N.
| Molecular formula | C16H12O7 |
|---|---|
| Molecular weight | 316.26 g/mol |
| IUPAC name | 5-[(2-carboxyphenyl)methoxy]benzene-1,3-dicarboxylic acid |
| InChIKey | LWQMQSPUNXSIJG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC2=CC(=CC(=C2)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)