Products 1261920-72-2
CAS 1261920-72-2 appears in our catalog under these names: 3-(4-Cyanophenyl)-5-methoxybenzoic acid, 95%, 4'-Cyano-5-methoxy-(1,1'-biphenyl)-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3-(4-cyanophenyl)-5-methoxybenzoic acid (CAS 1261920-72-2) is a chemical compound with the molecular formula C15H11NO3 and a molecular weight of 253.25 g/mol. IUPAC name: 3-(4-cyanophenyl)-5-methoxybenzoic acid. InChIKey: OYUAQCQKKWSPFH-UHFFFAOYSA-N.
| Molecular formula | C15H11NO3 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | 3-(4-cyanophenyl)-5-methoxybenzoic acid |
| InChIKey | OYUAQCQKKWSPFH-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C(=O)O)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)