Products 1261922-93-3
CAS 1261922-93-3 is the registry number for 6-[4-(Piperidinocarbonyl)phenyl]picolinic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-[4-(piperidine-1-carbonyl)phenyl]pyridine-2-carboxylic acid (CAS 1261922-93-3) is a chemical compound with the molecular formula C18H18N2O3 and a molecular weight of 310.3 g/mol. IUPAC name: 6-[4-(piperidine-1-carbonyl)phenyl]pyridine-2-carboxylic acid. InChIKey: HPFFGBNOMBLPGN-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O3 |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | 6-[4-(piperidine-1-carbonyl)phenyl]pyridine-2-carboxylic acid |
| InChIKey | HPFFGBNOMBLPGN-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=CC=C(C=C2)C3=NC(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)