Products 1261926-16-2

CAS 1261926-16-2 is the registry number for 5-Chloro-3-(thiophen-3-yl)benzoic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

3-chloro-5-thiophen-3-ylbenzoic acid (CAS 1261926-16-2) is a chemical compound with the molecular formula C11H7ClO2S and a molecular weight of 238.69 g/mol. IUPAC name: 3-chloro-5-thiophen-3-ylbenzoic acid. InChIKey: DBEVKQVIXLICPW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7ClO2S
Molecular weight238.69 g/mol
IUPAC name3-chloro-5-thiophen-3-ylbenzoic acid
InChIKeyDBEVKQVIXLICPW-UHFFFAOYSA-N
SMILESC1=CSC=C1C2=CC(=CC(=C2)Cl)C(=O)O

Computed by PubChem (NCBI)