CAS 500604-91-1 appears in our catalog under these names: 5-(2-Chlorophenyl)thiophene-2-carboxylic acid, 95%, 5-(2-Chlorophenyl)thiophene-2-carboxylic acid, 97%, 5-(2-Chlorophenyl)thiophene-2-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 10g, 5g, 0,5g, 0,25g, 2g.
5-(2-chlorophenyl)thiophene-2-carboxylic acid (CAS 500604-91-1) is a chemical compound with the molecular formula C11H7ClO2S and a molecular weight of 238.69 g/mol. IUPAC name: 5-(2-chlorophenyl)thiophene-2-carboxylic acid. InChIKey: NOTFXXFIWUZPOO-UHFFFAOYSA-N.
| Molecular formula | C11H7ClO2S |
|---|---|
| Molecular weight | 238.69 g/mol |
| IUPAC name | 5-(2-chlorophenyl)thiophene-2-carboxylic acid |
| InChIKey | NOTFXXFIWUZPOO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(S2)C(=O)O)Cl |
Computed by PubChem (NCBI)