CAS 1261933-39-4 appears in our catalog under these names: 4-(2-Chlorophenyl)-3-fluorobenzoic acid, 95%, 2'-Chloro-2-fluoro-(1,1'-biphenyl)-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
4-(2-chlorophenyl)-3-fluorobenzoic acid (CAS 1261933-39-4) is a chemical compound with the molecular formula C13H8ClFO2 and a molecular weight of 250.65 g/mol. IUPAC name: 4-(2-chlorophenyl)-3-fluorobenzoic acid. InChIKey: BOADDNMXVAXATO-UHFFFAOYSA-N.
| Molecular formula | C13H8ClFO2 |
|---|---|
| Molecular weight | 250.65 g/mol |
| IUPAC name | 4-(2-chlorophenyl)-3-fluorobenzoic acid |
| InChIKey | BOADDNMXVAXATO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C(C=C(C=C2)C(=O)O)F)Cl |
Computed by PubChem (NCBI)