CAS 844878-88-2 is the registry number for 4'-Chloro-3'-fluorobiphenyl-3-carboxylic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(4-chloro-3-fluorophenyl)benzoic acid (CAS 844878-88-2) is a chemical compound with the molecular formula C13H8ClFO2 and a molecular weight of 250.65 g/mol. IUPAC name: 3-(4-chloro-3-fluorophenyl)benzoic acid. InChIKey: XUVRJVFOZGVLCJ-UHFFFAOYSA-N.
| Molecular formula | C13H8ClFO2 |
|---|---|
| Molecular weight | 250.65 g/mol |
| IUPAC name | 3-(4-chloro-3-fluorophenyl)benzoic acid |
| InChIKey | XUVRJVFOZGVLCJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC(=C(C=C2)Cl)F |
Computed by PubChem (NCBI)