Products 1261936-42-8
CAS 1261936-42-8 is the registry number for 4'-Chloro-5-fluoro-2'-methoxy(1,1'-biphenyl)-3-ol. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
3-(4-chloro-2-methoxyphenyl)-5-fluorophenol (CAS 1261936-42-8) is a chemical compound with the molecular formula C13H10ClFO2 and a molecular weight of 252.67 g/mol. IUPAC name: 3-(4-chloro-2-methoxyphenyl)-5-fluorophenol. InChIKey: BEVHEUXCHWAXDJ-UHFFFAOYSA-N.
| Molecular formula | C13H10ClFO2 |
|---|---|
| Molecular weight | 252.67 g/mol |
| IUPAC name | 3-(4-chloro-2-methoxyphenyl)-5-fluorophenol |
| InChIKey | BEVHEUXCHWAXDJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Cl)C2=CC(=CC(=C2)F)O |
Computed by PubChem (NCBI)