CAS 1881290-88-5 appears in our catalog under these names: 3-(benzyloxy)-4-chloro-2-fluorophenol, 96%, 3-(Benzyloxy)-4-chloro-2-fluorophenol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-chloro-2-fluoro-3-phenylmethoxyphenol (CAS 1881290-88-5) is a chemical compound with the molecular formula C13H10ClFO2 and a molecular weight of 252.67 g/mol. IUPAC name: 4-chloro-2-fluoro-3-phenylmethoxyphenol. InChIKey: UAWKWDZRHUAJKP-UHFFFAOYSA-N.
| Molecular formula | C13H10ClFO2 |
|---|---|
| Molecular weight | 252.67 g/mol |
| IUPAC name | 4-chloro-2-fluoro-3-phenylmethoxyphenol |
| InChIKey | UAWKWDZRHUAJKP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC(=C2F)O)Cl |
Computed by PubChem (NCBI)