Products 1261940-97-9
CAS 1261940-97-9 is the registry number for 2-(3-Fluoro-4-methylphenyl)benzoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-(3-fluoro-4-methylphenyl)benzoic acid (CAS 1261940-97-9) is a chemical compound with the molecular formula C14H11FO2 and a molecular weight of 230.23 g/mol. IUPAC name: 2-(3-fluoro-4-methylphenyl)benzoic acid. InChIKey: GQJRYTXTCLCBMJ-UHFFFAOYSA-N.
| Molecular formula | C14H11FO2 |
|---|---|
| Molecular weight | 230.23 g/mol |
| IUPAC name | 2-(3-fluoro-4-methylphenyl)benzoic acid |
| InChIKey | GQJRYTXTCLCBMJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC=CC=C2C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
3'-Fluoro-4'-methyl-[1,1'-biphenyl]-2-carboxylic acid, 3/'-Fluoro-4/'-Methyl-[1,1/'-biphenyl]-2-carboxylic acid, [1,1'-Biphenyl]-2-carboxylic acid, 3'-fluoro-4'-methyl-, 3'-Fluoro-4'-methyl-[1,1'-biphenyl]-2-carboxylicacid, 2-(3-fluoro-4-methyl-phenyl)benzoic acid, 3'-Fluoro-4'-methyl[1,1'-biphenyl]-2-carboxylic acid