CAS 1261948-53-1 is the registry number for 5-(4-Fluoro-2-hydroxyphenyl)-2-methylphenol. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
5-(4-fluoro-2-hydroxyphenyl)-2-methylphenol (CAS 1261948-53-1) is a chemical compound with the molecular formula C13H11FO2 and a molecular weight of 218.22 g/mol. IUPAC name: 5-(4-fluoro-2-hydroxyphenyl)-2-methylphenol. InChIKey: GRSOXVYEEVZJKZ-UHFFFAOYSA-N.
| Molecular formula | C13H11FO2 |
|---|---|
| Molecular weight | 218.22 g/mol |
| IUPAC name | 5-(4-fluoro-2-hydroxyphenyl)-2-methylphenol |
| InChIKey | GRSOXVYEEVZJKZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=C(C=C(C=C2)F)O)O |
Computed by PubChem (NCBI)