CAS 1261952-48-0 is the registry number for 3-Fluoro-4-[5-(methoxycarbonyl)thiophen-3-yl]phenol, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 4-(2-fluoro-4-hydroxyphenyl)thiophene-2-carboxylate (CAS 1261952-48-0) is a chemical compound with the molecular formula C12H9FO3S and a molecular weight of 252.26 g/mol. IUPAC name: methyl 4-(2-fluoro-4-hydroxyphenyl)thiophene-2-carboxylate. InChIKey: QKOTZMYMVCFHRM-UHFFFAOYSA-N.
| Molecular formula | C12H9FO3S |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | methyl 4-(2-fluoro-4-hydroxyphenyl)thiophene-2-carboxylate |
| InChIKey | QKOTZMYMVCFHRM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CS1)C2=C(C=C(C=C2)O)F |
Computed by PubChem (NCBI)