CAS 1368838-37-2 appears in our catalog under these names: 4-Phenoxybenzenesulfonyl fluoride, 95%, 4-PHENOXYBENZENESULFONYL FLUORIDE. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 1g.
4-phenoxybenzenesulfonyl fluoride (CAS 1368838-37-2) is a chemical compound with the molecular formula C12H9FO3S and a molecular weight of 252.26 g/mol. IUPAC name: 4-phenoxybenzenesulfonyl fluoride. InChIKey: PDXOBGGAZNQARB-UHFFFAOYSA-N.
| Molecular formula | C12H9FO3S |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | 4-phenoxybenzenesulfonyl fluoride |
| InChIKey | PDXOBGGAZNQARB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)S(=O)(=O)F |
Computed by PubChem (NCBI)