Products 1261969-57-6

CAS 1261969-57-6 is the registry number for 3-Fluoro-4-(4-formylphenyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

3-fluoro-4-(4-formylphenyl)benzoic acid (CAS 1261969-57-6) is a chemical compound with the molecular formula C14H9FO3 and a molecular weight of 244.22 g/mol. IUPAC name: 3-fluoro-4-(4-formylphenyl)benzoic acid. InChIKey: SGWIJMSLNUZJOB-UHFFFAOYSA-N.

Identity
Molecular formulaC14H9FO3
Molecular weight244.22 g/mol
IUPAC name3-fluoro-4-(4-formylphenyl)benzoic acid
InChIKeySGWIJMSLNUZJOB-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C=O)C2=C(C=C(C=C2)C(=O)O)F

Computed by PubChem (NCBI)