CAS 332929-51-8 is the registry number for 3-Formylphenyl 3-fluorobenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-formylphenyl) 3-fluorobenzoate (CAS 332929-51-8) is a chemical compound with the molecular formula C14H9FO3 and a molecular weight of 244.22 g/mol. IUPAC name: (3-formylphenyl) 3-fluorobenzoate. InChIKey: YUPHYVTYCFDIBD-UHFFFAOYSA-N.
| Molecular formula | C14H9FO3 |
|---|---|
| Molecular weight | 244.22 g/mol |
| IUPAC name | (3-formylphenyl) 3-fluorobenzoate |
| InChIKey | YUPHYVTYCFDIBD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(=O)C2=CC(=CC=C2)F)C=O |
Computed by PubChem (NCBI)