CAS 126198-74-1 appears in our catalog under these names: Benzyl (7-methyloctyl) phthalate, 95+%, Benzyl Isononyl Phthalate (mixture of branched chain isomers), Benzyl (7-methyloctyl) phthalate, Benzyl (7-methyloctyl) phthalate, 98%. Offered by: AmBeed, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
2-O-benzyl 1-O-(7-methyloctyl) benzene-1,2-dicarboxylate (CAS 126198-74-1) is a chemical compound with the molecular formula C24H30O4 and a molecular weight of 382.5 g/mol. IUPAC name: 2-O-benzyl 1-O-(7-methyloctyl) benzene-1,2-dicarboxylate. InChIKey: IZTZLYGDXPHVQF-UHFFFAOYSA-N.
| Molecular formula | C24H30O4 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | 2-O-benzyl 1-O-(7-methyloctyl) benzene-1,2-dicarboxylate |
| InChIKey | IZTZLYGDXPHVQF-UHFFFAOYSA-N |
| SMILES | CC(C)CCCCCCOC(=O)C1=CC=CC=C1C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)