CAS 982-89-8 appears in our catalog under these names: Megestrol Acetate EP Impurity E, Megestrol Acetate Impurity 5(Megestrol Acetate EP Impurity E), 1-Dehydromegesterol Acetate. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(8R,9S,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate (CAS 982-89-8) is a chemical compound with the molecular formula C24H30O4 and a molecular weight of 382.5 g/mol. IUPAC name: [(8R,9S,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate. InChIKey: KWFVYECGPYJCJR-GQFGMJRRSA-N.
| Molecular formula | C24H30O4 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | [(8R,9S,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate |
| InChIKey | KWFVYECGPYJCJR-GQFGMJRRSA-N |
| SMILES | CC1=C[C@H]2[C@@H]3CC[C@@]([C@]3(CC[C@@H]2[C@@]4(C1=CC(=O)C=C4)C)C)(C(=O)C)OC(=O)C |
Computed by PubChem (NCBI)