Products 1262004-87-4
CAS 1262004-87-4 is the registry number for 5-Methoxy-3-(2-methylphenyl)benzoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
3-methoxy-5-(2-methylphenyl)benzoic acid (CAS 1262004-87-4) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 3-methoxy-5-(2-methylphenyl)benzoic acid. InChIKey: GHZOBRISDGBAHL-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 3-methoxy-5-(2-methylphenyl)benzoic acid |
| InChIKey | GHZOBRISDGBAHL-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=CC(=CC(=C2)OC)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-Methoxy-2'-methyl-[1,1'-biphenyl]-3-carboxylic acid, 3-methoxy-5-(2-methylphenyl)benzoic acid, [1,1'-Biphenyl]-3-carboxylic acid, 5-methoxy-2'-methyl-, 5-Methoxy-2'-methyl-[1,1'-biphenyl]-3-carboxylicacid, 3-methoxy-5-(o-tolyl)benzoic acid, 5-Methoxy-2'-methyl[1,1'-biphenyl]-3-carboxylic acid