Products 1262010-56-9

CAS 1262010-56-9 is the registry number for 3-(4-Fluorophenyl)-5-trifluoromethylbenzoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

3-(4-fluorophenyl)-5-(trifluoromethyl)benzoic acid (CAS 1262010-56-9) is a chemical compound with the molecular formula C14H8F4O2 and a molecular weight of 284.20 g/mol. IUPAC name: 3-(4-fluorophenyl)-5-(trifluoromethyl)benzoic acid. InChIKey: GXEMQUNYBDUJCM-UHFFFAOYSA-N.

Identity
Molecular formulaC14H8F4O2
Molecular weight284.20 g/mol
IUPAC name3-(4-fluorophenyl)-5-(trifluoromethyl)benzoic acid
InChIKeyGXEMQUNYBDUJCM-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=CC(=CC(=C2)C(F)(F)F)C(=O)O)F

Computed by PubChem (NCBI)