CAS 218929-27-2 is the registry number for 4-Fluorophenyl 3-(trifluoromethyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
(4-fluorophenyl) 3-(trifluoromethyl)benzoate (CAS 218929-27-2) is a chemical compound with the molecular formula C14H8F4O2 and a molecular weight of 284.20 g/mol. IUPAC name: (4-fluorophenyl) 3-(trifluoromethyl)benzoate. InChIKey: FDOAXLUDEAKGGJ-UHFFFAOYSA-N.
| Molecular formula | C14H8F4O2 |
|---|---|
| Molecular weight | 284.20 g/mol |
| IUPAC name | (4-fluorophenyl) 3-(trifluoromethyl)benzoate |
| InChIKey | FDOAXLUDEAKGGJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C(=O)OC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)