CAS 1262131-72-5 is the registry number for PHD2-IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(7-oxo-3H-[1,2,4]triazolo[1,5-a]pyridine-8-carbonyl)amino]acetic acid;hydrochloride (CAS 1262131-72-5) is a chemical compound with the molecular formula C9H9ClN4O4 and a molecular weight of 272.64 g/mol. IUPAC name: 2-[(7-oxo-3H-[1,2,4]triazolo[1,5-a]pyridine-8-carbonyl)amino]acetic acid;hydrochloride. InChIKey: IQYWUIFKNZLFJD-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN4O4 |
|---|---|
| Molecular weight | 272.64 g/mol |
| IUPAC name | 2-[(7-oxo-3H-[1,2,4]triazolo[1,5-a]pyridine-8-carbonyl)amino]acetic acid;hydrochloride |
| InChIKey | IQYWUIFKNZLFJD-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C(C1=O)C(=O)NCC(=O)O)N=CN2.Cl |
Computed by PubChem (NCBI)