CAS 372975-34-3 is the registry number for 3-[(7-Chloro-4-nitro-2,1,3-benzoxadiazol-5-yl)amino]propan-1-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-[(7-chloro-4-nitro-2,1,3-benzoxadiazol-5-yl)amino]propan-1-ol (CAS 372975-34-3) is a chemical compound with the molecular formula C9H9ClN4O4 and a molecular weight of 272.64 g/mol. IUPAC name: 3-[(7-chloro-4-nitro-2,1,3-benzoxadiazol-5-yl)amino]propan-1-ol. InChIKey: MEDGYQJLQCPHTI-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN4O4 |
|---|---|
| Molecular weight | 272.64 g/mol |
| IUPAC name | 3-[(7-chloro-4-nitro-2,1,3-benzoxadiazol-5-yl)amino]propan-1-ol |
| InChIKey | MEDGYQJLQCPHTI-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NON=C2C(=C1NCCCO)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)