CAS 1262132-81-9 appears in our catalog under these names: Enarodustat, 95%, Enarodustat, Enarodustat/ 99.61% (existing batch purity), JTZ 951, Enarodustat 97%. Offered by: Combi-blocks, Chemat Brand, TargetMol, Biosynth, Ambeed. Available pack sizes: 100mg, on request, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg.
2-[[7-oxo-5-(2-phenylethyl)-3H-[1,2,4]triazolo[1,5-a]pyridine-8-carbonyl]amino]acetic acid (CAS 1262132-81-9) is a chemical compound with the molecular formula C17H16N4O4 and a molecular weight of 340.33 g/mol. IUPAC name: 2-[[7-oxo-5-(2-phenylethyl)-3H-[1,2,4]triazolo[1,5-a]pyridine-8-carbonyl]amino]acetic acid. InChIKey: FJYRBJKWDXVHHO-UHFFFAOYSA-N.
| Molecular formula | C17H16N4O4 |
|---|---|
| Molecular weight | 340.33 g/mol |
| IUPAC name | 2-[[7-oxo-5-(2-phenylethyl)-3H-[1,2,4]triazolo[1,5-a]pyridine-8-carbonyl]amino]acetic acid |
| InChIKey | FJYRBJKWDXVHHO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC2=CC(=O)C(=C3N2NC=N3)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)