CAS 2512-29-0 appears in our catalog under these names: Hansa yellow, 95%, Hansa Yellow (Technical Grade), Pigment Yellow 1, Fast Yellow, Hansa Yellow. Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, Biosynth, TCI. Available pack sizes: 25g, 5g, 1g, 500mg, 50mg, 50g, 100g, 250g.
2-[(4-methyl-2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide (CAS 2512-29-0) is a chemical compound with the molecular formula C17H16N4O4 and a molecular weight of 340.33 g/mol. IUPAC name: 2-[(4-methyl-2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide. InChIKey: MFYSUUPKMDJYPF-UHFFFAOYSA-N.
| Molecular formula | C17H16N4O4 |
|---|---|
| Molecular weight | 340.33 g/mol |
| IUPAC name | 2-[(4-methyl-2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide |
| InChIKey | MFYSUUPKMDJYPF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N=NC(C(=O)C)C(=O)NC2=CC=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)