Products 1262395-13-0
CAS 1262395-13-0 is the registry number for NMS-P515, 98.18%. Offered by: MedChemExpress, Chemat. Available pack sizes: 100 mg, 50 mg, 10 mg, 25 mg, 5 mg, 1mg, 5mg, 10mg.
(1S)-2-(1-cyclohexylpiperidin-4-yl)-1-methyl-3-oxo-1H-isoindole-4-carboxamide (CAS 1262395-13-0) is a chemical compound with the molecular formula C21H29N3O2 and a molecular weight of 355.5 g/mol. IUPAC name: (1S)-2-(1-cyclohexylpiperidin-4-yl)-1-methyl-3-oxo-1H-isoindole-4-carboxamide. InChIKey: OYGLTKXMFGWXJT-AWEZNQCLSA-N.
| Molecular formula | C21H29N3O2 |
|---|---|
| Molecular weight | 355.5 g/mol |
| IUPAC name | (1S)-2-(1-cyclohexylpiperidin-4-yl)-1-methyl-3-oxo-1H-isoindole-4-carboxamide |
| InChIKey | OYGLTKXMFGWXJT-AWEZNQCLSA-N |
| SMILES | C[C@H]1C2=C(C(=CC=C2)C(=O)N)C(=O)N1C3CCN(CC3)C4CCCCC4 |
Computed by PubChem (NCBI)