Products 2219330-90-0
CAS 2219330-90-0 appears in our catalog under these names: AB–CHMICA, AB-Chiminaca. Offered by: GLPBio, Biosynth. Available pack sizes: 1mg, 5mg, 50mg, 10mg, 25mg.
N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-(cyclohexylmethyl)indole-3-carboxamide (CAS 2219330-90-0) is a chemical compound with the molecular formula C21H29N3O2 and a molecular weight of 355.5 g/mol. IUPAC name: N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-(cyclohexylmethyl)indole-3-carboxamide. InChIKey: BLLKAWANSRRHLA-IBGZPJMESA-N.
| Molecular formula | C21H29N3O2 |
|---|---|
| Molecular weight | 355.5 g/mol |
| IUPAC name | N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-(cyclohexylmethyl)indole-3-carboxamide |
| InChIKey | BLLKAWANSRRHLA-IBGZPJMESA-N |
| SMILES | CC(C)[C@@H](C(=O)N)NC(=O)C1=CN(C2=CC=CC=C21)CC3CCCCC3 |
Computed by PubChem (NCBI)