CAS 1262400-04-3 is the registry number for (1-(Trifluoromethyl)cyclopropyl)methyl methanesulfonate, 98%. Offered by: AmBeed. Available pack sizes: 5g.
[1-(trifluoromethyl)cyclopropyl]methyl methanesulfonate (CAS 1262400-04-3) is a chemical compound with the molecular formula C6H9F3O3S and a molecular weight of 218.20 g/mol. IUPAC name: [1-(trifluoromethyl)cyclopropyl]methyl methanesulfonate. InChIKey: TUFQPWHECWZNKA-UHFFFAOYSA-N.
| Molecular formula | C6H9F3O3S |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | [1-(trifluoromethyl)cyclopropyl]methyl methanesulfonate |
| InChIKey | TUFQPWHECWZNKA-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCC1(CC1)C(F)(F)F |
Computed by PubChem (NCBI)