CAS 2126163-06-0 is the registry number for 1-Cyclopropyl-2,2,2-trifluoroethyl methanesulfonate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1-cyclopropyl-2,2,2-trifluoroethyl) methanesulfonate (CAS 2126163-06-0) is a chemical compound with the molecular formula C6H9F3O3S and a molecular weight of 218.20 g/mol. IUPAC name: (1-cyclopropyl-2,2,2-trifluoroethyl) methanesulfonate. InChIKey: BGIDBWBZNUWFGV-UHFFFAOYSA-N.
| Molecular formula | C6H9F3O3S |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | (1-cyclopropyl-2,2,2-trifluoroethyl) methanesulfonate |
| InChIKey | BGIDBWBZNUWFGV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC(C1CC1)C(F)(F)F |
Computed by PubChem (NCBI)