CAS 1262412-52-1 is the registry number for 3-Methyl-4-(1,2,4-oxadiazol-3-yl)benzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methyl-4-(1,2,4-oxadiazol-3-yl)benzaldehyde (CAS 1262412-52-1) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 3-methyl-4-(1,2,4-oxadiazol-3-yl)benzaldehyde. InChIKey: ZCZDLWFWYZOUMU-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 3-methyl-4-(1,2,4-oxadiazol-3-yl)benzaldehyde |
| InChIKey | ZCZDLWFWYZOUMU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C=O)C2=NOC=N2 |
Computed by PubChem (NCBI)