CAS 1262412-66-7 is the registry number for 3-Fluoro-4-(1,2,4-oxadiazol-3-yl)benzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-fluoro-4-(1,2,4-oxadiazol-3-yl)benzaldehyde (CAS 1262412-66-7) is a chemical compound with the molecular formula C9H5FN2O2 and a molecular weight of 192.15 g/mol. IUPAC name: 3-fluoro-4-(1,2,4-oxadiazol-3-yl)benzaldehyde. InChIKey: AXRUFJYGMWLUKK-UHFFFAOYSA-N.
| Molecular formula | C9H5FN2O2 |
|---|---|
| Molecular weight | 192.15 g/mol |
| IUPAC name | 3-fluoro-4-(1,2,4-oxadiazol-3-yl)benzaldehyde |
| InChIKey | AXRUFJYGMWLUKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)F)C2=NOC=N2 |
Computed by PubChem (NCBI)