CAS 151982-49-9 is the registry number for 7-Fluoro-3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazine-6-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-fluoro-3-oxo-4H-1,4-benzoxazine-6-carbonitrile (CAS 151982-49-9) is a chemical compound with the molecular formula C9H5FN2O2 and a molecular weight of 192.15 g/mol. IUPAC name: 7-fluoro-3-oxo-4H-1,4-benzoxazine-6-carbonitrile. InChIKey: LIRPOUWIAUDIJY-UHFFFAOYSA-N.
| Molecular formula | C9H5FN2O2 |
|---|---|
| Molecular weight | 192.15 g/mol |
| IUPAC name | 7-fluoro-3-oxo-4H-1,4-benzoxazine-6-carbonitrile |
| InChIKey | LIRPOUWIAUDIJY-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=C(C(=C2)C#N)F |
Computed by PubChem (NCBI)