CAS 1262412-93-0 is the registry number for 4-(1,2,4-Oxadiazol-3-yl)-3-(trifluoromethyl)benzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(1,2,4-oxadiazol-3-yl)-3-(trifluoromethyl)benzaldehyde (CAS 1262412-93-0) is a chemical compound with the molecular formula C10H5F3N2O2 and a molecular weight of 242.15 g/mol. IUPAC name: 4-(1,2,4-oxadiazol-3-yl)-3-(trifluoromethyl)benzaldehyde. InChIKey: LBHILRGEZJCRQD-UHFFFAOYSA-N.
| Molecular formula | C10H5F3N2O2 |
|---|---|
| Molecular weight | 242.15 g/mol |
| IUPAC name | 4-(1,2,4-oxadiazol-3-yl)-3-(trifluoromethyl)benzaldehyde |
| InChIKey | LBHILRGEZJCRQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)C(F)(F)F)C2=NOC=N2 |
Computed by PubChem (NCBI)