CAS 241154-08-5 appears in our catalog under these names: 2-(Trifluoromethyl)-1,8-naphthyridine-3-carboxylic acid, 95%, 2-(Trifluoromethyl)-1,8-napthyridine-3-carboxylic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g.
2-(trifluoromethyl)-1,8-naphthyridine-3-carboxylic acid (CAS 241154-08-5) is a chemical compound with the molecular formula C10H5F3N2O2 and a molecular weight of 242.15 g/mol. IUPAC name: 2-(trifluoromethyl)-1,8-naphthyridine-3-carboxylic acid. InChIKey: VADNFSJODZWNRD-UHFFFAOYSA-N.
| Molecular formula | C10H5F3N2O2 |
|---|---|
| Molecular weight | 242.15 g/mol |
| IUPAC name | 2-(trifluoromethyl)-1,8-naphthyridine-3-carboxylic acid |
| InChIKey | VADNFSJODZWNRD-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(N=C2N=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)