CAS 1262413-56-8 is the registry number for 1-Fluoro-4-nitro-2-(2,2,2-trifluoroethyl)-benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
1-fluoro-4-nitro-2-(2,2,2-trifluoroethyl)benzene (CAS 1262413-56-8) is a chemical compound with the molecular formula C8H5F4NO2 and a molecular weight of 223.12 g/mol. IUPAC name: 1-fluoro-4-nitro-2-(2,2,2-trifluoroethyl)benzene. InChIKey: GIKRGEUVGUHLTQ-UHFFFAOYSA-N.
| Molecular formula | C8H5F4NO2 |
|---|---|
| Molecular weight | 223.12 g/mol |
| IUPAC name | 1-fluoro-4-nitro-2-(2,2,2-trifluoroethyl)benzene |
| InChIKey | GIKRGEUVGUHLTQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])CC(F)(F)F)F |
Computed by PubChem (NCBI)