Products 1804053-00-6
CAS 1804053-00-6 is the registry number for Methyl 5-fluoro-6-(trifluoromethyl)nicotinate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Methyl 5-fluoro-6-(trifluoromethyl)pyridine-3-carboxylate (CAS 1804053-00-6) is a chemical compound with the molecular formula C8H5F4NO2 and a molecular weight of 223.12 g/mol. IUPAC name: methyl 5-fluoro-6-(trifluoromethyl)pyridine-3-carboxylate. InChIKey: XVMWJNLIVAVWME-UHFFFAOYSA-N.
| Molecular formula | C8H5F4NO2 |
|---|---|
| Molecular weight | 223.12 g/mol |
| IUPAC name | methyl 5-fluoro-6-(trifluoromethyl)pyridine-3-carboxylate |
| InChIKey | XVMWJNLIVAVWME-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1)C(F)(F)F)F |
Computed by PubChem (NCBI)