Products 1262416-25-0
CAS 1262416-25-0 is the registry number for 5-Chloro-6-iodoisoindolin-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-chloro-6-iodo-2,3-dihydroisoindol-1-one (CAS 1262416-25-0) is a chemical compound with the molecular formula C8H5ClINO and a molecular weight of 293.49 g/mol. IUPAC name: 5-chloro-6-iodo-2,3-dihydroisoindol-1-one. InChIKey: ZALBOOFGCKNNOM-UHFFFAOYSA-N.
| Molecular formula | C8H5ClINO |
|---|---|
| Molecular weight | 293.49 g/mol |
| IUPAC name | 5-chloro-6-iodo-2,3-dihydroisoindol-1-one |
| InChIKey | ZALBOOFGCKNNOM-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C=C2C(=O)N1)I)Cl |
Computed by PubChem (NCBI)