CAS 2386535-58-4 is the registry number for 3-Chloro-2-iodo-6-methoxybenzonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-2-iodo-6-methoxybenzonitrile (CAS 2386535-58-4) is a chemical compound with the molecular formula C8H5ClINO and a molecular weight of 293.49 g/mol. IUPAC name: 3-chloro-2-iodo-6-methoxybenzonitrile. InChIKey: OSUFXRZCQOJAMQ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClINO |
|---|---|
| Molecular weight | 293.49 g/mol |
| IUPAC name | 3-chloro-2-iodo-6-methoxybenzonitrile |
| InChIKey | OSUFXRZCQOJAMQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Cl)I)C#N |
Computed by PubChem (NCBI)